C33H39NO6S — CID 146164299
(3R,4R,5S,6R)-2-cyclohexylsulfanyl-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 146164299) has the molecular formula C33H39NO6S and a molecular weight of 577.74 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-cyclohexylsulfanyl-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (3R,4R,5S,6R)-2-cyclohexylsulfanyl-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 146164299 |
| Molecular Formula | C33H39NO6S |
| Molecular Weight | 577.74 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | (3R,4R,5S,6R)-2-cyclohexylsulfanyl-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | O=[N+]([O-])[C@H]1C(SC2CCCCC2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H39NO6S/c35-34(36)30-32(39-23-27-17-9-3-10-18-27)31(38-22-26-15-7-2-8-16-26)29(24-37-21-25-13-5-1-6-14-25)40-33(30)41-28-19-11-4-12-20-28/h1-3,5-10,13-18,28-33H,4,11-12,19-24H2/t29-,30-,31-,32-,33?/m1/s1 |
| InChIKey | QITWAXMCFVHLDC-SVBJYHHJSA-N |
| XLogP | 6.81 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.74 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|