C33H35NO6 — CID 171556807
2-cyclohexa-1,5-dien-1-yl-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 171556807) has the molecular formula C33H35NO6 and a molecular weight of 541.64 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 171556807 |
| Molecular Formula | C33H35NO6 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | O=[N+]([O-])C1C(C2=CCCC=C2)OC(COCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C33H35NO6/c35-34(36)30-31(28-19-11-4-12-20-28)40-29(24-37-21-25-13-5-1-6-14-25)32(38-22-26-15-7-2-8-16-26)33(30)39-23-27-17-9-3-10-18-27/h1-3,5-11,13-20,29-33H,4,12,21-24H2 |
| InChIKey | AUXGEHIAGVWPIP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|