C51H55NO11 — CID 15487815
1-O-tert-butyl 4-O-[[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate (PubChem CID 15487815) has the molecular formula C51H55NO11 and a molecular weight of 858.00 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-[[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate.
| Compound Name | 1-O-tert-butyl 4-O-[[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate |
|---|---|
| PubChem CID | 15487815 |
| Molecular Formula | C51H55NO11 |
| Molecular Weight | 858.00 g/mol |
| Exact Mass | 857.38 |
| IUPAC Name | 1-O-tert-butyl 4-O-[[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate |
| SMILES | CO[C@H]1O[C@H](COC(=O)C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OC(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C51H55NO11/c1-51(2,3)63-48(54)42(52-50(55)61-32-41-39-26-16-14-24-37(39)38-25-15-17-27-40(38)41)28-44(53)57-33-43-45(58-29-34-18-8-5-9-19-34)46(59-30-35-20-10-6-11-21-35)47(49(56-4)62-43)60-31-36-22-12-7-13-23-36/h5-27,41-43,45-47,49H,28-33H2,1-4H3,(H,52,55)/t42-,43+,45+,46-,47-,49-/m0/s1 |
| InChIKey | RKYMFCZUFVCMEC-IYGAYKMBSA-N |
| XLogP | 8.30 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.00 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|