C56H57NO10 — CID 160832823
methyl (2S)-3-[(2S,4R,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate (PubChem CID 160832823) has the molecular formula C56H57NO10 and a molecular weight of 904.07 g/mol. Its IUPAC name is methyl (2S)-3-[(2S,4R,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2S)-3-[(2S,4R,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 160832823 |
| Molecular Formula | C56H57NO10 |
| Molecular Weight | 904.07 g/mol |
| Exact Mass | 903.40 |
| IUPAC Name | methyl (2S)-3-[(2S,4R,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
| SMILES | C=C[C@]1(OC(C)[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OC)OC(COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C56H57NO10/c1-4-56(66-39(2)50(54(58)60-3)57-55(59)65-37-48-46-31-19-17-29-44(46)45-30-18-20-32-47(45)48)53(64-36-43-27-15-8-16-28-43)52(63-35-42-25-13-7-14-26-42)51(62-34-41-23-11-6-12-24-41)49(67-56)38-61-33-40-21-9-5-10-22-40/h4-32,39,48-53H,1,33-38H2,2-3H3,(H,57,59)/t39?,49?,50-,51-,52+,53?,56-/m0/s1 |
| InChIKey | SHAFNIISEQGNAA-PPGHQLEMSA-N |
| XLogP | 9.73 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.07 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|