C23H28O4 — CID 166519075
(2S,3R,4R,5R)-2-methoxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-3-prop-2-enyloxolane (PubChem CID 166519075) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-methoxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-3-prop-2-enyloxolane.
| Compound Name | (2S,3R,4R,5R)-2-methoxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-3-prop-2-enyloxolane |
|---|---|
| PubChem CID | 166519075 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (2S,3R,4R,5R)-2-methoxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-3-prop-2-enyloxolane |
| SMILES | C=CC[C@H]1[C@@H](OC)O[C@H](COCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H28O4/c1-3-10-20-22(26-16-19-13-8-5-9-14-19)21(27-23(20)24-2)17-25-15-18-11-6-4-7-12-18/h3-9,11-14,20-23H,1,10,15-17H2,2H3/t20-,21-,22-,23+/m1/s1 |
| InChIKey | URWHAKDEMXTMMS-ODAXIHTASA-N |
| XLogP | 4.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|