C37H42O7 — CID 15756018
[(2S,3R,4S,5R,6R)-2-ethoxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanol (PubChem CID 15756018) has the molecular formula C37H42O7 and a molecular weight of 598.74 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2-ethoxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanol.
| Compound Name | [(2S,3R,4S,5R,6R)-2-ethoxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 15756018 |
| Molecular Formula | C37H42O7 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2-ethoxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanol |
| SMILES | CCO[C@@]1(CO)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H42O7/c1-2-43-37(28-38)36(42-26-32-21-13-6-14-22-32)35(41-25-31-19-11-5-12-20-31)34(40-24-30-17-9-4-10-18-30)33(44-37)27-39-23-29-15-7-3-8-16-29/h3-22,33-36,38H,2,23-28H2,1H3/t33-,34-,35+,36-,37+/m1/s1 |
| InChIKey | UXWUAUJNGCTQGU-MANRWTMFSA-N |
| XLogP | 6.08 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |