C36H40O6 — CID 14445991
(3R,4S,5R,6R)-2-ethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 14445991) has the molecular formula C36H40O6 and a molecular weight of 568.71 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-ethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-2-ethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 14445991 |
| Molecular Formula | C36H40O6 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | (3R,4S,5R,6R)-2-ethyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | CCC1(O)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H40O6/c1-2-36(37)35(41-26-31-21-13-6-14-22-31)34(40-25-30-19-11-5-12-20-30)33(39-24-29-17-9-4-10-18-29)32(42-36)27-38-23-28-15-7-3-8-16-28/h3-22,32-35,37H,2,23-27H2,1H3/t32-,33-,34+,35-,36?/m1/s1 |
| InChIKey | WEDQBCXQKOPAGE-KXCACMGXSA-N |
| XLogP | 6.46 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |