C36H40N2O6 — CID 101123709
(2S,3R,4S,5R,6R)-2-[(2E)-2-hydrazinylideneethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 101123709) has the molecular formula C36H40N2O6 and a molecular weight of 596.72 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[(2E)-2-hydrazinylideneethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[(2E)-2-hydrazinylideneethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 101123709 |
| Molecular Formula | C36H40N2O6 |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[(2E)-2-hydrazinylideneethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | N/N=C/C[C@]1(O)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H40N2O6/c37-38-22-21-36(39)35(43-26-31-19-11-4-12-20-31)34(42-25-30-17-9-3-10-18-30)33(41-24-29-15-7-2-8-16-29)32(44-36)27-40-23-28-13-5-1-6-14-28/h1-20,22,32-35,39H,21,23-27,37H2/b38-22+/t32-,33-,34+,35-,36+/m1/s1 |
| InChIKey | VIDJGAAPXKSFBW-DIRFUMPUSA-N |
| XLogP | 5.38 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|