C41H48O6 — CID 122383294
(2S,3S,4R,5S,6R,8S)-8,9,9-trimethyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undecane (PubChem CID 122383294) has the molecular formula C41H48O6 and a molecular weight of 636.83 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R,8S)-8,9,9-trimethyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2S,3S,4R,5S,6R,8S)-8,9,9-trimethyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 122383294 |
| Molecular Formula | C41H48O6 |
| Molecular Weight | 636.83 g/mol |
| Exact Mass | 636.35 |
| IUPAC Name | (2S,3S,4R,5S,6R,8S)-8,9,9-trimethyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undecane |
| SMILES | C[C@@H]1O[C@]2(CCC1(C)C)O[C@@H](COCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C41H48O6/c1-31-40(2,3)24-25-41(46-31)39(45-29-35-22-14-7-15-23-35)38(44-28-34-20-12-6-13-21-34)37(43-27-33-18-10-5-11-19-33)36(47-41)30-42-26-32-16-8-4-9-17-32/h4-23,31,36-39H,24-30H2,1-3H3/t31-,36-,37-,38+,39-,41+/m0/s1 |
| InChIKey | XMQUKOPDJQYPDT-QNRCSQGLSA-N |
| XLogP | 8.28 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.83 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |