C40H43NO8 — CID 102416803
ethyl (6R,8R,9R,10S,11R)-9,10,11-tris(phenylmethoxy)-8-(phenylmethoxymethyl)-1,7-dioxa-2-azaspiro[5.5]undec-2-ene-3-carboxylate (PubChem CID 102416803) has the molecular formula C40H43NO8 and a molecular weight of 665.78 g/mol. Its IUPAC name is ethyl (6R,8R,9R,10S,11R)-9,10,11-tris(phenylmethoxy)-8-(phenylmethoxymethyl)-1,7-dioxa-2-azaspiro[5.5]undec-2-ene-3-carboxylate.
| Compound Name | ethyl (6R,8R,9R,10S,11R)-9,10,11-tris(phenylmethoxy)-8-(phenylmethoxymethyl)-1,7-dioxa-2-azaspiro[5.5]undec-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 102416803 |
| Molecular Formula | C40H43NO8 |
| Molecular Weight | 665.78 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | ethyl (6R,8R,9R,10S,11R)-9,10,11-tris(phenylmethoxy)-8-(phenylmethoxymethyl)-1,7-dioxa-2-azaspiro[5.5]undec-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=NO[C@@]2(CC1)O[C@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C40H43NO8/c1-2-44-39(42)34-23-24-40(49-41-34)38(47-28-33-21-13-6-14-22-33)37(46-27-32-19-11-5-12-20-32)36(45-26-31-17-9-4-10-18-31)35(48-40)29-43-25-30-15-7-3-8-16-30/h3-22,35-38H,2,23-29H2,1H3/t35-,36-,37+,38-,40-/m1/s1 |
| InChIKey | HVMUEKAOGPLSDR-DROOIBKBSA-N |
| XLogP | 6.78 |
| TPSA | 94.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.78 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |