C46H49NO8 — CID 101232463
ethyl (3R,5R,6R,7S,8R)-2-benzyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]decane-3-carboxylate (PubChem CID 101232463) has the molecular formula C46H49NO8 and a molecular weight of 743.90 g/mol. Its IUPAC name is ethyl (3R,5R,6R,7S,8R)-2-benzyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl (3R,5R,6R,7S,8R)-2-benzyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 101232463 |
| Molecular Formula | C46H49NO8 |
| Molecular Weight | 743.90 g/mol |
| Exact Mass | 743.35 |
| IUPAC Name | ethyl (3R,5R,6R,7S,8R)-2-benzyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]decane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@]2(OC(COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)ON1Cc1ccccc1 |
| InChI | InChI=1S/C46H49NO8/c1-2-50-45(48)40-28-46(55-47(40)29-35-18-8-3-9-19-35)44(53-33-39-26-16-7-17-27-39)43(52-32-38-24-14-6-15-25-38)42(51-31-37-22-12-5-13-23-37)41(54-46)34-49-30-36-20-10-4-11-21-36/h3-27,40-44H,2,28-34H2,1H3/t40-,41?,42-,43+,44-,46-/m1/s1 |
| InChIKey | NNDBUSVQPGXRHA-MAHSIZNPSA-N |
| XLogP | 7.82 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.90 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |