C32H34O6S — CID 100942077
1-[(2R,3S,4S,5R)-7-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,6-dioxa-9-thiaspiro[4.5]dec-7-en-8-yl]ethanone (PubChem CID 100942077) has the molecular formula C32H34O6S and a molecular weight of 546.69 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-7-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,6-dioxa-9-thiaspiro[4.5]dec-7-en-8-yl]ethanone.
| Compound Name | 1-[(2R,3S,4S,5R)-7-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,6-dioxa-9-thiaspiro[4.5]dec-7-en-8-yl]ethanone |
|---|---|
| PubChem CID | 100942077 |
| Molecular Formula | C32H34O6S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-7-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,6-dioxa-9-thiaspiro[4.5]dec-7-en-8-yl]ethanone |
| SMILES | CC(=O)C1=C(C)O[C@]2(CS1)O[C@H](COCc1ccccc1)[C@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C32H34O6S/c1-23(33)30-24(2)37-32(22-39-30)31(36-20-27-16-10-5-11-17-27)29(35-19-26-14-8-4-9-15-26)28(38-32)21-34-18-25-12-6-3-7-13-25/h3-17,28-29,31H,18-22H2,1-2H3/t28-,29+,31+,32-/m1/s1 |
| InChIKey | QYSZICVKFCHKJS-FZSDTKOLSA-N |
| XLogP | 6.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |