C30H32O5 — CID 51350318
1-[(1S,3R,4S,5R,6S,7S)-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2-oxabicyclo[4.1.0]heptan-7-yl]ethanone (PubChem CID 51350318) has the molecular formula C30H32O5 and a molecular weight of 472.58 g/mol. Its IUPAC name is 1-[(1S,3R,4S,5R,6S,7S)-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2-oxabicyclo[4.1.0]heptan-7-yl]ethanone.
| Compound Name | 1-[(1S,3R,4S,5R,6S,7S)-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2-oxabicyclo[4.1.0]heptan-7-yl]ethanone |
|---|---|
| PubChem CID | 51350318 |
| Molecular Formula | C30H32O5 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 1-[(1S,3R,4S,5R,6S,7S)-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2-oxabicyclo[4.1.0]heptan-7-yl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]21 |
| InChI | InChI=1S/C30H32O5/c1-21(31)26-27-29(26)35-25(20-32-17-22-11-5-2-6-12-22)28(33-18-23-13-7-3-8-14-23)30(27)34-19-24-15-9-4-10-16-24/h2-16,25-30H,17-20H2,1H3/t25-,26+,27+,28-,29-,30-/m1/s1 |
| InChIKey | ODHREFZJWDBUAD-URNDJICFSA-N |
| XLogP | 4.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |