C40H44O8 — CID 101168393
tert-butyl (2R,3R,4S,5S,6R,7R)-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)-1,8-dioxaspiro[2.5]octane-2-carboxylate (PubChem CID 101168393) has the molecular formula C40H44O8 and a molecular weight of 652.78 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S,5S,6R,7R)-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)-1,8-dioxaspiro[2.5]octane-2-carboxylate.
| Compound Name | tert-butyl (2R,3R,4S,5S,6R,7R)-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)-1,8-dioxaspiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 101168393 |
| Molecular Formula | C40H44O8 |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | tert-butyl (2R,3R,4S,5S,6R,7R)-4,5,6-tris(phenylmethoxy)-7-(phenylmethoxymethyl)-1,8-dioxaspiro[2.5]octane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1O[C@@]12O[C@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C40H44O8/c1-39(2,3)48-38(41)37-40(47-37)36(45-27-32-22-14-7-15-23-32)35(44-26-31-20-12-6-13-21-31)34(43-25-30-18-10-5-11-19-30)33(46-40)28-42-24-29-16-8-4-9-17-29/h4-23,33-37H,24-28H2,1-3H3/t33-,34-,35+,36+,37+,40-/m1/s1 |
| InChIKey | ASOQLTHQVYQIFX-NSHDAZKSSA-N |
| XLogP | 6.80 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|