C32H38O7 — CID 102356522
tert-butyl (2S,3S,4R,5S,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate (PubChem CID 102356522) has the molecular formula C32H38O7 and a molecular weight of 534.65 g/mol. Its IUPAC name is tert-butyl (2S,3S,4R,5S,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | tert-butyl (2S,3S,4R,5S,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 102356522 |
| Molecular Formula | C32H38O7 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | tert-butyl (2S,3S,4R,5S,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1O[C@@H](CO)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H38O7/c1-32(2,3)39-31(34)30-29(37-22-25-17-11-6-12-18-25)28(36-21-24-15-9-5-10-16-24)27(26(19-33)38-30)35-20-23-13-7-4-8-14-23/h4-18,26-30,33H,19-22H2,1-3H3/t26-,27-,28+,29-,30-/m0/s1 |
| InChIKey | JDFYKGRABQFATG-KTBGKDHWSA-N |
| XLogP | 4.84 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |