C31H34F2O7 — CID 101138797
ethyl 2,2-difluoro-2-[(2R,3R,4S,5R,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate (PubChem CID 101138797) has the molecular formula C31H34F2O7 and a molecular weight of 556.60 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-[(2R,3R,4S,5R,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate.
| Compound Name | ethyl 2,2-difluoro-2-[(2R,3R,4S,5R,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 101138797 |
| Molecular Formula | C31H34F2O7 |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | ethyl 2,2-difluoro-2-[(2R,3R,4S,5R,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate |
| SMILES | CCOC(=O)C(F)(F)[C@@H]1O[C@@H](CO)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H34F2O7/c1-2-36-30(35)31(32,33)29-28(39-21-24-16-10-5-11-17-24)27(38-20-23-14-8-4-9-15-23)26(25(18-34)40-29)37-19-22-12-6-3-7-13-22/h3-17,25-29,34H,2,18-21H2,1H3/t25-,26+,27-,28+,29+/m0/s1 |
| InChIKey | UHYJBYYIDBQPST-XPLNXOJDSA-N |
| XLogP | 4.70 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |