C32H36O5 — CID 11641847
[(2R,3S,4R,5S,6R)-6-pent-1-ynyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 11641847) has the molecular formula C32H36O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-6-pent-1-ynyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3S,4R,5S,6R)-6-pent-1-ynyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 11641847 |
| Molecular Formula | C32H36O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-6-pent-1-ynyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CCCC#C[C@H]1O[C@H](CO)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H36O5/c1-2-3-7-20-28-30(34-22-25-14-8-4-9-15-25)32(36-24-27-18-12-6-13-19-27)31(29(21-33)37-28)35-23-26-16-10-5-11-17-26/h4-6,8-19,28-33H,2-3,21-24H2,1H3/t28-,29-,30+,31+,32-/m1/s1 |
| InChIKey | GDRPZYSWPSZLOX-DSSMMGBBSA-N |
| XLogP | 5.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|