C36H35IO5 — CID 12020019
(2R,3S,4R,5R,6R)-2-(2-iodoethynyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 12020019) has the molecular formula C36H35IO5 and a molecular weight of 674.58 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-(2-iodoethynyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3S,4R,5R,6R)-2-(2-iodoethynyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 12020019 |
| Molecular Formula | C36H35IO5 |
| Molecular Weight | 674.58 g/mol |
| Exact Mass | 674.15 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-(2-iodoethynyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | IC#C[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H35IO5/c37-22-21-32-34(39-24-29-15-7-2-8-16-29)36(41-26-31-19-11-4-12-20-31)35(40-25-30-17-9-3-10-18-30)33(42-32)27-38-23-28-13-5-1-6-14-28/h1-20,32-36H,23-27H2/t32-,33-,34+,35-,36-/m1/s1 |
| InChIKey | IADBCKMLJDGNJO-SQGINLDNSA-N |
| XLogP | 7.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.58 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|