C36H35IO5S — CID 134570612
2-[(5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethynyl thiohypoiodite (PubChem CID 134570612) has the molecular formula C36H35IO5S and a molecular weight of 706.64 g/mol. Its IUPAC name is 2-[(5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethynyl thiohypoiodite.
| Compound Name | 2-[(5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 134570612 |
| Molecular Formula | C36H35IO5S |
| Molecular Weight | 706.64 g/mol |
| Exact Mass | 706.12 |
| IUPAC Name | 2-[(5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethynyl thiohypoiodite |
| SMILES | ISC#CC1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C36H35IO5S/c37-43-22-21-32-34(39-24-29-15-7-2-8-16-29)36(41-26-31-19-11-4-12-20-31)35(40-25-30-17-9-3-10-18-30)33(42-32)27-38-23-28-13-5-1-6-14-28/h1-20,32-36H,23-27H2/t32?,33?,34?,35-,36?/m1/s1 |
| InChIKey | PZKTWIXWGKGFII-LOTNTQDISA-N |
| XLogP | 7.77 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.64 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|