C32H40O6 — CID 139492016
[(2R,3R,4S,5R,6R)-6-[(2R)-pentan-2-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 139492016) has the molecular formula C32H40O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[(2R)-pentan-2-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[(2R)-pentan-2-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 139492016 |
| Molecular Formula | C32H40O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[(2R)-pentan-2-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CCC[C@@H](C)O[C@@H]1O[C@H](CO)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H40O6/c1-3-13-24(2)37-32-31(36-23-27-18-11-6-12-19-27)30(35-22-26-16-9-5-10-17-26)29(28(20-33)38-32)34-21-25-14-7-4-8-15-25/h4-12,14-19,24,28-33H,3,13,20-23H2,1-2H3/t24-,28-,29-,30+,31-,32-/m1/s1 |
| InChIKey | LVHYOPOUIHUYSM-LXEVNVBBSA-N |
| XLogP | 5.66 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |