C31H34F2O7 — CID 102089168
ethyl 2,2-difluoro-2-[(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate (PubChem CID 102089168) has the molecular formula C31H34F2O7 and a molecular weight of 556.60 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-[(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate.
| Compound Name | ethyl 2,2-difluoro-2-[(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 102089168 |
| Molecular Formula | C31H34F2O7 |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | ethyl 2,2-difluoro-2-[(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
| SMILES | CCOC(=O)C(F)(F)[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C31H34F2O7/c1-2-37-30(35)31(32,33)29-26(34)28(39-20-24-16-10-5-11-17-24)27(38-19-23-14-8-4-9-15-23)25(40-29)21-36-18-22-12-6-3-7-13-22/h3-17,25-29,34H,2,18-21H2,1H3/t25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | AFFWLCPCTMVTGK-JPHCZMGXSA-N |
| XLogP | 4.70 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |