C39H41F2NO9 — CID 57410838
4,4-difluoro-4-[(2S,3R,4R,5S,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 57410838) has the molecular formula C39H41F2NO9 and a molecular weight of 705.75 g/mol. Its IUPAC name is 4,4-difluoro-4-[(2S,3R,4R,5S,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4,4-difluoro-4-[(2S,3R,4R,5S,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 57410838 |
| Molecular Formula | C39H41F2NO9 |
| Molecular Weight | 705.75 g/mol |
| Exact Mass | 705.27 |
| IUPAC Name | 4,4-difluoro-4-[(2S,3R,4R,5S,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(NC(CC(F)(F)[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C39H41F2NO9/c40-39(41,21-31(37(44)45)42-38(46)50-25-30-19-11-4-12-20-30)36-33(43)35(49-24-29-17-9-3-10-18-29)34(48-23-28-15-7-2-8-16-28)32(51-36)26-47-22-27-13-5-1-6-14-27/h1-20,31-36,43H,21-26H2,(H,42,46)(H,44,45)/t31?,32-,33-,34+,35-,36+/m1/s1 |
| InChIKey | KRVNKBKNYJJGQW-FJUAQIJTSA-N |
| XLogP | 5.91 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.75 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |