C48H51F2NO9 — CID 57410113
ethyl 4,4-difluoro-2-(phenylmethoxycarbonylamino)-4-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate (PubChem CID 57410113) has the molecular formula C48H51F2NO9 and a molecular weight of 823.93 g/mol. Its IUPAC name is ethyl 4,4-difluoro-2-(phenylmethoxycarbonylamino)-4-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate.
| Compound Name | ethyl 4,4-difluoro-2-(phenylmethoxycarbonylamino)-4-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate |
|---|---|
| PubChem CID | 57410113 |
| Molecular Formula | C48H51F2NO9 |
| Molecular Weight | 823.93 g/mol |
| Exact Mass | 823.35 |
| IUPAC Name | ethyl 4,4-difluoro-2-(phenylmethoxycarbonylamino)-4-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate |
| SMILES | CCOC(=O)C(CC(F)(F)[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C48H51F2NO9/c1-2-55-46(52)40(51-47(53)59-33-39-26-16-7-17-27-39)28-48(49,50)45-44(58-32-38-24-14-6-15-25-38)43(57-31-37-22-12-5-13-23-37)42(56-30-36-20-10-4-11-21-36)41(60-45)34-54-29-35-18-8-3-9-19-35/h3-27,40-45H,2,28-34H2,1H3,(H,51,53)/t40?,41-,42+,43+,44-,45-/m1/s1 |
| InChIKey | SHGPFPNRRWAVIA-AAYYJWGMSA-N |
| XLogP | 8.61 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.93 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |