C41H45F2NO10 — CID 57410589
(2S)-4,4-difluoro-4-[(2S,3R,4S,5S,6R)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 57410589) has the molecular formula C41H45F2NO10 and a molecular weight of 749.80 g/mol. Its IUPAC name is (2S)-4,4-difluoro-4-[(2S,3R,4S,5S,6R)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4,4-difluoro-4-[(2S,3R,4S,5S,6R)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 57410589 |
| Molecular Formula | C41H45F2NO10 |
| Molecular Weight | 749.80 g/mol |
| Exact Mass | 749.30 |
| IUPAC Name | (2S)-4,4-difluoro-4-[(2S,3R,4S,5S,6R)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | COCO[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1C(F)(F)C[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C41H45F2NO10/c1-48-28-53-37-36(51-25-31-18-10-4-11-19-31)35(50-24-30-16-8-3-9-17-30)34(27-49-23-29-14-6-2-7-15-29)54-38(37)41(42,43)22-33(39(45)46)44-40(47)52-26-32-20-12-5-13-21-32/h2-21,33-38H,22-28H2,1H3,(H,44,47)(H,45,46)/t33-,34+,35-,36-,37+,38-/m0/s1 |
| InChIKey | YTRAXNIOCFJKLT-PHDGMBCWSA-N |
| XLogP | 6.54 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.80 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|