C36H38O7S — CID 10963137
O-phenyl (2R,3R,4S,5R,6R)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbothioate (PubChem CID 10963137) has the molecular formula C36H38O7S and a molecular weight of 614.76 g/mol. Its IUPAC name is O-phenyl (2R,3R,4S,5R,6R)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbothioate.
| Compound Name | O-phenyl (2R,3R,4S,5R,6R)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbothioate |
|---|---|
| PubChem CID | 10963137 |
| Molecular Formula | C36H38O7S |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | O-phenyl (2R,3R,4S,5R,6R)-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbothioate |
| SMILES | COCO[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H]1C(=S)Oc1ccccc1 |
| InChI | InChI=1S/C36H38O7S/c1-37-26-41-34-33(40-24-29-18-10-4-11-19-29)32(39-23-28-16-8-3-9-17-28)31(25-38-22-27-14-6-2-7-15-27)43-35(34)36(44)42-30-20-12-5-13-21-30/h2-21,31-35H,22-26H2,1H3/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | FEPSZOVXKYDHGV-CKQPALCZSA-N |
| XLogP | 6.54 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|