C28H33O7P — CID 71814425
(2S,3S,4S,5S,6R)-2-hydroxy-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxaphosphinane (PubChem CID 71814425) has the molecular formula C28H33O7P and a molecular weight of 512.54 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-hydroxy-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxaphosphinane.
| Compound Name | (2S,3S,4S,5S,6R)-2-hydroxy-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxaphosphinane |
|---|---|
| PubChem CID | 71814425 |
| Molecular Formula | C28H33O7P |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-hydroxy-3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxaphosphinane |
| SMILES | COCO[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[P@]1O |
| InChI | InChI=1S/C28H33O7P/c1-30-21-34-28-27(33-19-24-15-9-4-10-16-24)26(32-18-23-13-7-3-8-14-23)25(35-36(28)29)20-31-17-22-11-5-2-6-12-22/h2-16,25-29H,17-21H2,1H3/t25-,26-,27+,28+,36+/m1/s1 |
| InChIKey | NTMUIGMROXRWFJ-IUPFYGJLSA-N |
| XLogP | 5.02 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|