C27H31BO6P — CID 71812534
CID 71812534 (PubChem CID 71812534) has the molecular formula C27H31BO6P and a molecular weight of 493.33 g/mol.
| Compound Name | CID 71812534 |
|---|---|
| PubChem CID | 71812534 |
| Molecular Formula | C27H31BO6P |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | — |
| SMILES | CO[P@@]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1O.[B] |
| InChI | InChI=1S/C27H31O6P.B/c1-29-34-27(28)26(32-19-23-15-9-4-10-16-23)25(31-18-22-13-7-3-8-14-22)24(33-34)20-30-17-21-11-5-2-6-12-21;/h2-16,24-28H,17-20H2,1H3;/t24-,25-,26+,27-,34+;/m1./s1 |
| InChIKey | GLAVSZIWMSYKFY-PUAJFVGJSA-N |
| XLogP | 4.67 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|