C30H34O7 — CID 126561419
methyl 2-[(2R,3R,4S,5R,6R)-5-hydroxy-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate (PubChem CID 126561419) has the molecular formula C30H34O7 and a molecular weight of 506.60 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S,5R,6R)-5-hydroxy-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S,5R,6R)-5-hydroxy-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 126561419 |
| Molecular Formula | C30H34O7 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | methyl 2-[(2R,3R,4S,5R,6R)-5-hydroxy-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H34O7/c1-33-27(31)17-25-29(35-19-23-13-7-3-8-14-23)30(36-20-24-15-9-4-10-16-24)28(32)26(37-25)21-34-18-22-11-5-2-6-12-22/h2-16,25-26,28-30,32H,17-21H2,1H3/t25-,26-,28-,29-,30+/m1/s1 |
| InChIKey | UAKCRICKGHKTOD-FXQVUQSNSA-N |
| XLogP | 4.07 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |