C30H35NO6 — CID 11145593
methyl 2-[(2S,3S,4R,5R,6R)-6-(aminomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate (PubChem CID 11145593) has the molecular formula C30H35NO6 and a molecular weight of 505.61 g/mol. Its IUPAC name is methyl 2-[(2S,3S,4R,5R,6R)-6-(aminomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3S,4R,5R,6R)-6-(aminomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 11145593 |
| Molecular Formula | C30H35NO6 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | methyl 2-[(2S,3S,4R,5R,6R)-6-(aminomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](CN)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H35NO6/c1-33-27(32)17-25-28(34-19-22-11-5-2-6-12-22)30(36-21-24-15-9-4-10-16-24)29(26(18-31)37-25)35-20-23-13-7-3-8-14-23/h2-16,25-26,28-30H,17-21,31H2,1H3/t25-,26+,28-,29+,30+/m0/s1 |
| InChIKey | HFXURKQOKSLJTG-RRRWTVAESA-N |
| XLogP | 4.03 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |