C24H28O5S — CID 11430295
S-[[(2R,3R,4S)-5-(2-oxopropyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl] ethanethioate (PubChem CID 11430295) has the molecular formula C24H28O5S and a molecular weight of 428.55 g/mol. Its IUPAC name is S-[[(2R,3R,4S)-5-(2-oxopropyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl] ethanethioate.
| Compound Name | S-[[(2R,3R,4S)-5-(2-oxopropyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 11430295 |
| Molecular Formula | C24H28O5S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | S-[[(2R,3R,4S)-5-(2-oxopropyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl] ethanethioate |
| SMILES | CC(=O)CC1O[C@@H](CSC(C)=O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H28O5S/c1-17(25)13-21-23(27-14-19-9-5-3-6-10-19)24(22(29-21)16-30-18(2)26)28-15-20-11-7-4-8-12-20/h3-12,21-24H,13-16H2,1-2H3/t21?,22-,23-,24-/m0/s1 |
| InChIKey | VELNQRMRPFEHKS-NSBVFQKPSA-N |
| XLogP | 4.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|