C21H32O4S — CID 59585089
S-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methyl] ethanethioate (PubChem CID 59585089) has the molecular formula C21H32O4S and a molecular weight of 380.55 g/mol. Its IUPAC name is S-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methyl] ethanethioate.
| Compound Name | S-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 59585089 |
| Molecular Formula | C21H32O4S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | S-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methyl] ethanethioate |
| SMILES | CCCCO[C@H]1O[C@H](CSC(C)=O)[C@@H](C)[C@H](C)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H32O4S/c1-5-6-12-23-21-20(24-13-18-10-8-7-9-11-18)16(3)15(2)19(25-21)14-26-17(4)22/h7-11,15-16,19-21H,5-6,12-14H2,1-4H3/t15-,16-,19+,20+,21-/m0/s1 |
| InChIKey | ROYNVJFOXVMNLH-KHDMTIDOSA-N |
| XLogP | 4.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|