C28H44O7 — CID 167680469
[(2S,4S,5R)-2-[(3S,4R,6R)-4-butoxy-5,6-dimethyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-5-ethyl-4-methyloxolan-3-yl] acetate (PubChem CID 167680469) has the molecular formula C28H44O7 and a molecular weight of 492.65 g/mol. Its IUPAC name is [(2S,4S,5R)-2-[(3S,4R,6R)-4-butoxy-5,6-dimethyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-5-ethyl-4-methyloxolan-3-yl] acetate.
| Compound Name | [(2S,4S,5R)-2-[(3S,4R,6R)-4-butoxy-5,6-dimethyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-5-ethyl-4-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 167680469 |
| Molecular Formula | C28H44O7 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | [(2S,4S,5R)-2-[(3S,4R,6R)-4-butoxy-5,6-dimethyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-5-ethyl-4-methyloxolan-3-yl] acetate |
| SMILES | CCCCO[C@@H]1C(C)[C@@H](C)OC(COCc2ccccc2)[C@H]1O[C@@H]1O[C@H](CC)[C@H](C)C1OC(C)=O |
| InChI | InChI=1S/C28H44O7/c1-7-9-15-31-25-18(3)20(5)32-24(17-30-16-22-13-11-10-12-14-22)27(25)35-28-26(33-21(6)29)19(4)23(8-2)34-28/h10-14,18-20,23-28H,7-9,15-17H2,1-6H3/t18?,19-,20+,23+,24?,25+,26?,27+,28-/m0/s1 |
| InChIKey | VIVCMACXBJQHQE-LSBYPXJQSA-N |
| XLogP | 4.90 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|