C39H66O10 — CID 167554070
[(2S,4S,5R)-4,5-dibutoxy-2-[(2R,4S,5R)-3-butoxy-2,5-dimethyl-6-(phenylmethoxymethyl)oxan-4-yl]oxy-6-(butoxymethyl)oxan-3-yl] acetate (PubChem CID 167554070) has the molecular formula C39H66O10 and a molecular weight of 694.95 g/mol. Its IUPAC name is [(2S,4S,5R)-4,5-dibutoxy-2-[(2R,4S,5R)-3-butoxy-2,5-dimethyl-6-(phenylmethoxymethyl)oxan-4-yl]oxy-6-(butoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,4S,5R)-4,5-dibutoxy-2-[(2R,4S,5R)-3-butoxy-2,5-dimethyl-6-(phenylmethoxymethyl)oxan-4-yl]oxy-6-(butoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 167554070 |
| Molecular Formula | C39H66O10 |
| Molecular Weight | 694.95 g/mol |
| Exact Mass | 694.47 |
| IUPAC Name | [(2S,4S,5R)-4,5-dibutoxy-2-[(2R,4S,5R)-3-butoxy-2,5-dimethyl-6-(phenylmethoxymethyl)oxan-4-yl]oxy-6-(butoxymethyl)oxan-3-yl] acetate |
| SMILES | CCCCOCC1O[C@H](O[C@@H]2C(OCCCC)[C@@H](C)OC(COCc3ccccc3)[C@H]2C)C(OC(C)=O)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C39H66O10/c1-8-12-21-41-27-33-36(44-23-14-10-3)37(45-24-15-11-4)38(47-30(7)40)39(48-33)49-34-28(5)32(26-42-25-31-19-17-16-18-20-31)46-29(6)35(34)43-22-13-9-2/h16-20,28-29,32-39H,8-15,21-27H2,1-7H3/t28-,29-,32?,33?,34+,35?,36-,37+,38?,39-/m1/s1 |
| InChIKey | WWRURQKUBBQJHL-CZDALCGHSA-N |
| XLogP | 7.04 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.95 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|