C37H49O10P — CID 10886959
[(2S,3R,4S,5S,6R)-2-dibutoxyphosphoryloxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] acetate (PubChem CID 10886959) has the molecular formula C37H49O10P and a molecular weight of 684.76 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-2-dibutoxyphosphoryloxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-2-dibutoxyphosphoryloxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 10886959 |
| Molecular Formula | C37H49O10P |
| Molecular Weight | 684.76 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-2-dibutoxyphosphoryloxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] acetate |
| SMILES | CCCCOP(=O)(OCCCC)O[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C37H49O10P/c1-4-6-23-43-48(39,44-24-7-5-2)47-37-36(45-29(3)38)35(42-27-32-21-15-10-16-22-32)34(41-26-31-19-13-9-14-20-31)33(46-37)28-40-25-30-17-11-8-12-18-30/h8-22,33-37H,4-7,23-28H2,1-3H3/t33-,34+,35+,36-,37+/m1/s1 |
| InChIKey | OEEWGCNSDJHSRW-AESTUDHESA-N |
| XLogP | 7.79 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.76 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|