C40H55O10P — CID 101159155
[(3R,4S,5S,6R)-2-dibutoxyphosphoryloxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 101159155) has the molecular formula C40H55O10P and a molecular weight of 726.84 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-2-dibutoxyphosphoryloxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4S,5S,6R)-2-dibutoxyphosphoryloxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101159155 |
| Molecular Formula | C40H55O10P |
| Molecular Weight | 726.84 g/mol |
| Exact Mass | 726.35 |
| IUPAC Name | [(3R,4S,5S,6R)-2-dibutoxyphosphoryloxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CCCCOP(=O)(OCCCC)OC1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C40H55O10P/c1-6-8-25-46-51(42,47-26-9-7-2)50-38-37(49-39(41)40(3,4)5)36(45-29-33-23-17-12-18-24-33)35(44-28-32-21-15-11-16-22-32)34(48-38)30-43-27-31-19-13-10-14-20-31/h10-24,34-38H,6-9,25-30H2,1-5H3/t34-,35+,36+,37-,38?/m1/s1 |
| InChIKey | HMLTWSCKAYAWBY-CTIUUEMMSA-N |
| XLogP | 8.81 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.84 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|