C50H57O11P — CID 135078190
[2-dibutoxyphosphoryloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl] 9H-fluoren-9-ylmethyl carbonate (PubChem CID 135078190) has the molecular formula C50H57O11P and a molecular weight of 864.97 g/mol. Its IUPAC name is [2-dibutoxyphosphoryloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl] 9H-fluoren-9-ylmethyl carbonate.
| Compound Name | [2-dibutoxyphosphoryloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl] 9H-fluoren-9-ylmethyl carbonate |
|---|---|
| PubChem CID | 135078190 |
| Molecular Formula | C50H57O11P |
| Molecular Weight | 864.97 g/mol |
| Exact Mass | 864.36 |
| IUPAC Name | [2-dibutoxyphosphoryloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl] 9H-fluoren-9-ylmethyl carbonate |
| SMILES | CCCCOP(=O)(OCCCC)OC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OC(=O)OCC2c3ccccc3-c3ccccc32)C1OCc1ccccc1 |
| InChI | InChI=1S/C50H57O11P/c1-3-5-30-57-62(52,58-31-6-4-2)61-49-48(55-34-39-24-14-9-15-25-39)47(60-50(51)56-35-44-42-28-18-16-26-40(42)41-27-17-19-29-43(41)44)46(54-33-38-22-12-8-13-23-38)45(59-49)36-53-32-37-20-10-7-11-21-37/h7-29,44-49H,3-6,30-36H2,1-2H3 |
| InChIKey | PZGOIOAVXLWQMI-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.97 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|