C54H60NO10P — CID 10677228
[(3R,4S,5R,6R)-4-benzoyloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 9H-fluoren-9-ylmethyl phosphate;triethylazanium (PubChem CID 10677228) has the molecular formula C54H60NO10P and a molecular weight of 914.05 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4-benzoyloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 9H-fluoren-9-ylmethyl phosphate;triethylazanium.
| Compound Name | [(3R,4S,5R,6R)-4-benzoyloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 9H-fluoren-9-ylmethyl phosphate;triethylazanium |
|---|---|
| PubChem CID | 10677228 |
| Molecular Formula | C54H60NO10P |
| Molecular Weight | 914.05 g/mol |
| Exact Mass | 913.40 |
| IUPAC Name | [(3R,4S,5R,6R)-4-benzoyloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 9H-fluoren-9-ylmethyl phosphate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=C(O[C@H]1[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)OC(OP(=O)([O-])OCC2c3ccccc3-c3ccccc32)[C@@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H45O10P.C6H15N/c49-47(37-23-11-4-12-24-37)57-45-44(53-30-35-19-7-2-8-20-35)43(33-52-29-34-17-5-1-6-18-34)56-48(46(45)54-31-36-21-9-3-10-22-36)58-59(50,51)55-32-42-40-27-15-13-25-38(40)39-26-14-16-28-41(39)42;1-4-7(5-2)6-3/h1-28,42-46,48H,29-33H2,(H,50,51);4-6H2,1-3H3/t43-,44-,45+,46-,48?;/m1./s1 |
| InChIKey | DCRHSHTYCCQQDA-PSNGVTJUSA-N |
| XLogP | 8.57 |
| TPSA | 126.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.05 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|