C41H50NO12P — CID 11479794
[(2R,3S,4R,5R,6S)-6-dibutoxyphosphoryloxy-5-(1,3-dioxoisoindol-2-yl)-3,4-bis(phenylmethoxy)oxan-2-yl]methyl 4-oxopentanoate (PubChem CID 11479794) has the molecular formula C41H50NO12P and a molecular weight of 779.82 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-dibutoxyphosphoryloxy-5-(1,3-dioxoisoindol-2-yl)-3,4-bis(phenylmethoxy)oxan-2-yl]methyl 4-oxopentanoate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-dibutoxyphosphoryloxy-5-(1,3-dioxoisoindol-2-yl)-3,4-bis(phenylmethoxy)oxan-2-yl]methyl 4-oxopentanoate |
|---|---|
| PubChem CID | 11479794 |
| Molecular Formula | C41H50NO12P |
| Molecular Weight | 779.82 g/mol |
| Exact Mass | 779.31 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-dibutoxyphosphoryloxy-5-(1,3-dioxoisoindol-2-yl)-3,4-bis(phenylmethoxy)oxan-2-yl]methyl 4-oxopentanoate |
| SMILES | CCCCOP(=O)(OCCCC)O[C@@H]1O[C@H](COC(=O)CCC(C)=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C41H50NO12P/c1-4-6-24-51-55(47,52-25-7-5-2)54-41-36(42-39(45)32-20-14-15-21-33(32)40(42)46)38(50-27-31-18-12-9-13-19-31)37(49-26-30-16-10-8-11-17-30)34(53-41)28-48-35(44)23-22-29(3)43/h8-21,34,36-38,41H,4-7,22-28H2,1-3H3/t34-,36-,37-,38-,41+/m1/s1 |
| InChIKey | UDLYLJNMVCZTAU-VLCOZADESA-N |
| XLogP | 7.22 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.82 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|