C41H54NO12P — CID 101220435
[(2R,3S,4R,5R,6S)-6-dibutoxyphosphoryloxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl 4-oxopentanoate (PubChem CID 101220435) has the molecular formula C41H54NO12P and a molecular weight of 783.85 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-dibutoxyphosphoryloxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl 4-oxopentanoate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-dibutoxyphosphoryloxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl 4-oxopentanoate |
|---|---|
| PubChem CID | 101220435 |
| Molecular Formula | C41H54NO12P |
| Molecular Weight | 783.85 g/mol |
| Exact Mass | 783.34 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-dibutoxyphosphoryloxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl 4-oxopentanoate |
| SMILES | CCCCOP(=O)(OCCCC)O[C@@H]1O[C@H](COC(=O)CCC(C)=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H54NO12P/c1-4-6-25-51-55(46,52-26-7-5-2)54-40-37(42-41(45)50-29-34-21-15-10-16-22-34)39(49-28-33-19-13-9-14-20-33)38(48-27-32-17-11-8-12-18-32)35(53-40)30-47-36(44)24-23-31(3)43/h8-22,35,37-40H,4-7,23-30H2,1-3H3,(H,42,45)/t35-,37-,38-,39-,40+/m1/s1 |
| InChIKey | OVYKYLQYNPMLRD-WQTWDYGGSA-N |
| XLogP | 7.85 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.85 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|