C41H49Cl3NO9P — CID 56642502
dibutyl [(2R,3R,4R,5R,6R)-5-(naphthalen-2-ylmethoxy)-4-phenylmethoxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl] phosphate (PubChem CID 56642502) has the molecular formula C41H49Cl3NO9P and a molecular weight of 837.17 g/mol. Its IUPAC name is dibutyl [(2R,3R,4R,5R,6R)-5-(naphthalen-2-ylmethoxy)-4-phenylmethoxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl] phosphate.
| Compound Name | dibutyl [(2R,3R,4R,5R,6R)-5-(naphthalen-2-ylmethoxy)-4-phenylmethoxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 56642502 |
| Molecular Formula | C41H49Cl3NO9P |
| Molecular Weight | 837.17 g/mol |
| Exact Mass | 835.22 |
| IUPAC Name | dibutyl [(2R,3R,4R,5R,6R)-5-(naphthalen-2-ylmethoxy)-4-phenylmethoxy-6-(phenylmethoxymethyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl] phosphate |
| SMILES | CCCCOP(=O)(OCCCC)O[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccc3ccccc3c2)[C@H](OCc2ccccc2)[C@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C41H49Cl3NO9P/c1-3-5-23-51-55(47,52-24-6-4-2)54-39-36(45-40(46)41(42,43)44)38(50-27-31-17-11-8-12-18-31)37(35(53-39)29-48-26-30-15-9-7-10-16-30)49-28-32-21-22-33-19-13-14-20-34(33)25-32/h7-22,25,35-39H,3-6,23-24,26-29H2,1-2H3,(H,45,46)/t35-,36-,37+,38-,39-/m1/s1 |
| InChIKey | YLQBOPWUOKZVSW-GFRPZHATSA-N |
| XLogP | 9.87 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.17 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|