C38H55O12P — CID 85404407
[2-dibutoxyphosphoryloxy-3-(2,2-dimethylpropanoyloxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl] 4-oxopentanoate (PubChem CID 85404407) has the molecular formula C38H55O12P and a molecular weight of 734.82 g/mol. Its IUPAC name is [2-dibutoxyphosphoryloxy-3-(2,2-dimethylpropanoyloxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl] 4-oxopentanoate.
| Compound Name | [2-dibutoxyphosphoryloxy-3-(2,2-dimethylpropanoyloxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 85404407 |
| Molecular Formula | C38H55O12P |
| Molecular Weight | 734.82 g/mol |
| Exact Mass | 734.34 |
| IUPAC Name | [2-dibutoxyphosphoryloxy-3-(2,2-dimethylpropanoyloxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl] 4-oxopentanoate |
| SMILES | CCCCOP(=O)(OCCCC)OC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OC(=O)CCC(C)=O)C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C38H55O12P/c1-7-9-23-45-51(42,46-24-10-8-2)50-36-35(49-37(41)38(4,5)6)34(48-32(40)22-21-28(3)39)33(44-26-30-19-15-12-16-20-30)31(47-36)27-43-25-29-17-13-11-14-18-29/h11-20,31,33-36H,7-10,21-27H2,1-6H3 |
| InChIKey | LBUYVTPPEQGIFF-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.82 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|