C33H46O8 — CID 10995393
[(2S,3S,4S,5R,6R)-3-(2,2-dimethylpropanoyloxy)-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl] (3S)-3,4-dimethylpentanoate (PubChem CID 10995393) has the molecular formula C33H46O8 and a molecular weight of 570.72 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-3-(2,2-dimethylpropanoyloxy)-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl] (3S)-3,4-dimethylpentanoate.
| Compound Name | [(2S,3S,4S,5R,6R)-3-(2,2-dimethylpropanoyloxy)-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl] (3S)-3,4-dimethylpentanoate |
|---|---|
| PubChem CID | 10995393 |
| Molecular Formula | C33H46O8 |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-3-(2,2-dimethylpropanoyloxy)-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-yl] (3S)-3,4-dimethylpentanoate |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OC(=O)C[C@H](C)C(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C33H46O8/c1-22(2)23(3)18-27(34)40-29-28(38-20-25-16-12-9-13-17-25)26(21-37-19-24-14-10-8-11-15-24)39-31(36-7)30(29)41-32(35)33(4,5)6/h8-17,22-23,26,28-31H,18-21H2,1-7H3/t23-,26+,28+,29-,30-,31-/m0/s1 |
| InChIKey | XJABYVVAWUAEFQ-SZEBMGTJSA-N |
| XLogP | 5.71 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |