C34H40O7 — CID 11734416
[(2S,3S,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] (3R)-3-methylpent-4-enoate (PubChem CID 11734416) has the molecular formula C34H40O7 and a molecular weight of 560.69 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] (3R)-3-methylpent-4-enoate.
| Compound Name | [(2S,3S,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] (3R)-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 11734416 |
| Molecular Formula | C34H40O7 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] (3R)-3-methylpent-4-enoate |
| SMILES | C=C[C@H](C)CC(=O)O[C@@H]1[C@@H](OC)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H40O7/c1-4-25(2)20-30(35)41-33-32(39-23-28-18-12-7-13-19-28)31(38-22-27-16-10-6-11-17-27)29(40-34(33)36-3)24-37-21-26-14-8-5-9-15-26/h4-19,25,29,31-34H,1,20-24H2,2-3H3/t25-,29+,31+,32-,33-,34-/m0/s1 |
| InChIKey | LESGUYBASHKMJT-MXQKJOJYSA-N |
| XLogP | 5.87 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|