C32H42O8 — CID 101053235
[(2R,3R,4S,5R,6S)-3-(2,2-dimethylpropanoyloxy)-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl (3R)-3-methylpent-4-enoate (PubChem CID 101053235) has the molecular formula C32H42O8 and a molecular weight of 554.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3-(2,2-dimethylpropanoyloxy)-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl (3R)-3-methylpent-4-enoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3-(2,2-dimethylpropanoyloxy)-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl (3R)-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 101053235 |
| Molecular Formula | C32H42O8 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3-(2,2-dimethylpropanoyloxy)-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl (3R)-3-methylpent-4-enoate |
| SMILES | C=C[C@H](C)CC(=O)OC[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H42O8/c1-7-22(2)18-26(33)36-21-25-27(40-31(34)32(3,4)5)28(37-19-23-14-10-8-11-15-23)29(30(35-6)39-25)38-20-24-16-12-9-13-17-24/h7-17,22,25,27-30H,1,18-21H2,2-6H3/t22-,25+,27+,28-,29+,30-/m0/s1 |
| InChIKey | OJHKJZAKYLPWDM-IAOWIXDWSA-N |
| XLogP | 5.24 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|