C24H34O8 — CID 122385720
[(2R,3R,5S,6S)-5-(2,2-dimethylpropanoyloxy)-6-methoxy-4-oxo-3-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 122385720) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(2R,3R,5S,6S)-5-(2,2-dimethylpropanoyloxy)-6-methoxy-4-oxo-3-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,5S,6S)-5-(2,2-dimethylpropanoyloxy)-6-methoxy-4-oxo-3-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122385720 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(2R,3R,5S,6S)-5-(2,2-dimethylpropanoyloxy)-6-methoxy-4-oxo-3-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CO[C@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H](OCc2ccccc2)C(=O)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H34O8/c1-23(2,3)21(26)30-14-16-18(29-13-15-11-9-8-10-12-15)17(25)19(20(28-7)31-16)32-22(27)24(4,5)6/h8-12,16,18-20H,13-14H2,1-7H3/t16-,18-,19-,20+/m1/s1 |
| InChIKey | RTPWXLIEUWMMRC-AFYVEPGGSA-N |
| XLogP | 3.06 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |