C25H35N3O8 — CID 10940114
[(2R,3S,4R,5S,6R)-3-acetyloxy-5-azido-4-(2,2-dimethylpropanoyloxy)-6-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10940114) has the molecular formula C25H35N3O8 and a molecular weight of 505.57 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3-acetyloxy-5-azido-4-(2,2-dimethylpropanoyloxy)-6-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R,5S,6R)-3-acetyloxy-5-azido-4-(2,2-dimethylpropanoyloxy)-6-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10940114 |
| Molecular Formula | C25H35N3O8 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3-acetyloxy-5-azido-4-(2,2-dimethylpropanoyloxy)-6-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(=O)C(C)(C)C)[C@H](N=[N+]=[N-])[C@H](OCc2ccccc2)O[C@@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H35N3O8/c1-15(29)34-19-17(14-33-22(30)24(2,3)4)35-21(32-13-16-11-9-8-10-12-16)18(27-28-26)20(19)36-23(31)25(5,6)7/h8-12,17-21H,13-14H2,1-7H3/t17-,18+,19-,20-,21-/m1/s1 |
| InChIKey | LVYJPYUUCTWXOX-FDKIHUSFSA-N |
| XLogP | 4.09 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|