C34H43N3O10 — CID 101117591
[(2R,3S,4R,5S,6S)-3-acetyloxy-5-azido-4-(2,2-dimethylpropanoyloxy)-6-[4-(3-oxo-3-phenylmethoxypropyl)phenoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 101117591) has the molecular formula C34H43N3O10 and a molecular weight of 653.73 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3-acetyloxy-5-azido-4-(2,2-dimethylpropanoyloxy)-6-[4-(3-oxo-3-phenylmethoxypropyl)phenoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R,5S,6S)-3-acetyloxy-5-azido-4-(2,2-dimethylpropanoyloxy)-6-[4-(3-oxo-3-phenylmethoxypropyl)phenoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101117591 |
| Molecular Formula | C34H43N3O10 |
| Molecular Weight | 653.73 g/mol |
| Exact Mass | 653.29 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3-acetyloxy-5-azido-4-(2,2-dimethylpropanoyloxy)-6-[4-(3-oxo-3-phenylmethoxypropyl)phenoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(=O)C(C)(C)C)[C@H](N=[N+]=[N-])[C@H](Oc2ccc(CCC(=O)OCc3ccccc3)cc2)O[C@@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C34H43N3O10/c1-21(38)44-28-25(20-43-31(40)33(2,3)4)46-30(27(36-37-35)29(28)47-32(41)34(5,6)7)45-24-16-13-22(14-17-24)15-18-26(39)42-19-23-11-9-8-10-12-23/h8-14,16-17,25,27-30H,15,18-20H2,1-7H3/t25-,27+,28-,29-,30-/m1/s1 |
| InChIKey | KZAWHUWLZDPFBE-PMPPGDGWSA-N |
| XLogP | 5.62 |
| TPSA | 172.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.73 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|