C26H34O12 — CID 54573335
5-O-benzyl 1-O-[[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl] 2,2-dimethylpentanedioate (PubChem CID 54573335) has the molecular formula C26H34O12 and a molecular weight of 538.55 g/mol. Its IUPAC name is 5-O-benzyl 1-O-[[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl] 2,2-dimethylpentanedioate.
| Compound Name | 5-O-benzyl 1-O-[[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl] 2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 54573335 |
| Molecular Formula | C26H34O12 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 5-O-benzyl 1-O-[[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl] 2,2-dimethylpentanedioate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](O)O[C@H](COC(=O)C(C)(C)CCC(=O)OCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H34O12/c1-15(27)35-21-19(38-24(31)23(37-17(3)29)22(21)36-16(2)28)14-34-25(32)26(4,5)12-11-20(30)33-13-18-9-7-6-8-10-18/h6-10,19,21-24,31H,11-14H2,1-5H3/t19-,21+,22+,23-,24-/m1/s1 |
| InChIKey | ZYVWDVHYEZPENK-HYPCABPSSA-N |
| XLogP | 1.59 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|