C24H26N3O11P — CID 101353700
[(2R,3S,4R,5R)-3,4-diacetyloxy-5-azido-6-diphenoxyphosphoryloxyoxan-2-yl]methyl acetate (PubChem CID 101353700) has the molecular formula C24H26N3O11P and a molecular weight of 563.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-diacetyloxy-5-azido-6-diphenoxyphosphoryloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-azido-6-diphenoxyphosphoryloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101353700 |
| Molecular Formula | C24H26N3O11P |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-azido-6-diphenoxyphosphoryloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OP(=O)(Oc2ccccc2)Oc2ccccc2)[C@H](N=[N+]=[N-])[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H26N3O11P/c1-15(28)32-14-20-22(33-16(2)29)23(34-17(3)30)21(26-27-25)24(35-20)38-39(31,36-18-10-6-4-7-11-18)37-19-12-8-5-9-13-19/h4-13,20-24H,14H2,1-3H3/t20-,21-,22-,23-,24?/m1/s1 |
| InChIKey | AEMJMXBIIVFMNO-ZVCDOGERSA-N |
| XLogP | 4.10 |
| TPSA | 181.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|