C25H28NO13P — CID 118894753
[(2S,3R,4S,5S,6R)-4,5-diacetyloxy-6-diphenoxyphosphoryloxy-3-(formyloxyamino)oxan-2-yl]methyl acetate (PubChem CID 118894753) has the molecular formula C25H28NO13P and a molecular weight of 581.47 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-diacetyloxy-6-diphenoxyphosphoryloxy-3-(formyloxyamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-diacetyloxy-6-diphenoxyphosphoryloxy-3-(formyloxyamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118894753 |
| Molecular Formula | C25H28NO13P |
| Molecular Weight | 581.47 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-diacetyloxy-6-diphenoxyphosphoryloxy-3-(formyloxyamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OP(=O)(Oc2ccccc2)Oc2ccccc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1NOC=O |
| InChI | InChI=1S/C25H28NO13P/c1-16(28)32-14-21-22(26-33-15-27)23(34-17(2)29)24(35-18(3)30)25(36-21)39-40(31,37-19-10-6-4-7-11-19)38-20-12-8-5-9-13-20/h4-13,15,21-26H,14H2,1-3H3/t21-,22-,23+,24+,25-/m1/s1 |
| InChIKey | FROVJPVMVYMUTJ-WJGLBBAVSA-N |
| XLogP | 2.47 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|